C10H12N4O2S — CID 117159283
4-(triazolo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide (PubChem CID 117159283) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 4-(triazolo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide.
| Compound Name | 4-(triazolo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117159283 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 4-(triazolo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(n2nnc3cccnc32)CC1 |
| InChI | InChI=1S/C10H12N4O2S/c15-17(16)6-3-8(4-7-17)14-10-9(12-13-14)2-1-5-11-10/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | OTTSGCZHBTVDKO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |