C11H14N4O2S — CID 117159296
4-(triazolo[4,5-b]pyridin-3-ylmethyl)thiane 1,1-dioxide (PubChem CID 117159296) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-(triazolo[4,5-b]pyridin-3-ylmethyl)thiane 1,1-dioxide.
| Compound Name | 4-(triazolo[4,5-b]pyridin-3-ylmethyl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117159296 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-(triazolo[4,5-b]pyridin-3-ylmethyl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Cn2nnc3cccnc32)CC1 |
| InChI | InChI=1S/C11H14N4O2S/c16-18(17)6-3-9(4-7-18)8-15-11-10(13-14-15)2-1-5-12-11/h1-2,5,9H,3-4,6-8H2 |
| InChIKey | QXITXQYKCSIHLM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |