C11H14N4S — CID 117159338
3-(thian-3-ylmethyl)triazolo[4,5-b]pyridine (PubChem CID 117159338) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 3-(thian-3-ylmethyl)triazolo[4,5-b]pyridine.
| Compound Name | 3-(thian-3-ylmethyl)triazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117159338 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-(thian-3-ylmethyl)triazolo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nnn2CC1CCCSC1 |
| InChI | InChI=1S/C11H14N4S/c1-4-10-11(12-5-1)15(14-13-10)7-9-3-2-6-16-8-9/h1,4-5,9H,2-3,6-8H2 |
| InChIKey | WEGXWUOGWUDEAY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |