C10H12N4S — CID 117159304
3-(thian-3-yl)triazolo[4,5-b]pyridine (PubChem CID 117159304) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 3-(thian-3-yl)triazolo[4,5-b]pyridine.
| Compound Name | 3-(thian-3-yl)triazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117159304 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-(thian-3-yl)triazolo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)nnn2C1CCCSC1 |
| InChI | InChI=1S/C10H12N4S/c1-4-9-10(11-5-1)14(13-12-9)8-3-2-6-15-7-8/h1,4-5,8H,2-3,6-7H2 |
| InChIKey | MXPIUSORRLJGRH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |