C9H14F6N5P — CID 141048536
trimethyl(triazolo[4,5-b]pyridin-3-ylmethyl)azanium hexafluorophosphate (PubChem CID 141048536) has the molecular formula C9H14F6N5P and a molecular weight of 337.21 g/mol. Its IUPAC name is trimethyl(triazolo[4,5-b]pyridin-3-ylmethyl)azanium hexafluorophosphate.
| Compound Name | trimethyl(triazolo[4,5-b]pyridin-3-ylmethyl)azanium hexafluorophosphate |
|---|---|
| PubChem CID | 141048536 |
| Molecular Formula | C9H14F6N5P |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | trimethyl(triazolo[4,5-b]pyridin-3-ylmethyl)azanium hexafluorophosphate |
| SMILES | C[N+](C)(C)Cn1nnc2cccnc21.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C9H14N5.F6P/c1-14(2,3)7-13-9-8(11-12-13)5-4-6-10-9;1-7(2,3,4,5)6/h4-6H,7H2,1-3H3;/q+1;-1 |
| InChIKey | APQOPRCYWZTJLX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|