C13H22F6N7O2P — CID 22667883
[dimethylamino(triazolo[4,5-b]pyridin-3-yloxy)methylidene]-dimethylazanium;N-methylacetamide;hexafluorophosphate (PubChem CID 22667883) has the molecular formula C13H22F6N7O2P and a molecular weight of 453.33 g/mol. Its IUPAC name is [dimethylamino(triazolo[4,5-b]pyridin-3-yloxy)methylidene]-dimethylazanium;N-methylacetamide;hexafluorophosphate.
| Compound Name | [dimethylamino(triazolo[4,5-b]pyridin-3-yloxy)methylidene]-dimethylazanium;N-methylacetamide;hexafluorophosphate |
|---|---|
| PubChem CID | 22667883 |
| Molecular Formula | C13H22F6N7O2P |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [dimethylamino(triazolo[4,5-b]pyridin-3-yloxy)methylidene]-dimethylazanium;N-methylacetamide;hexafluorophosphate |
| SMILES | CN(C)C(On1nnc2cccnc21)=[N+](C)C.CNC(C)=O.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C10H15N6O.C3H7NO.F6P/c1-14(2)10(15(3)4)17-16-9-8(12-13-16)6-5-7-11-9;1-3(5)4-2;1-7(2,3,4,5)6/h5-7H,1-4H3;1-2H3,(H,4,5);/q+1;;-1 |
| InChIKey | XTJBXTCPKBRWKX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|