C15H10N8O4 — CID 163873045
bis(triazolo[4,5-b]pyridin-3-yl) (E)-pent-2-enedioate (PubChem CID 163873045) has the molecular formula C15H10N8O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is bis(triazolo[4,5-b]pyridin-3-yl) (E)-pent-2-enedioate.
| Compound Name | bis(triazolo[4,5-b]pyridin-3-yl) (E)-pent-2-enedioate |
|---|---|
| PubChem CID | 163873045 |
| Molecular Formula | C15H10N8O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | bis(triazolo[4,5-b]pyridin-3-yl) (E)-pent-2-enedioate |
| SMILES | O=C(/C=C/CC(=O)On1nnc2cccnc21)On1nnc2cccnc21 |
| InChI | InChI=1S/C15H10N8O4/c24-12(26-22-14-10(18-20-22)4-2-8-16-14)6-1-7-13(25)27-23-15-11(19-21-23)5-3-9-17-15/h1-6,8-9H,7H2/b6-1+ |
| InChIKey | PMMMWHBMRDVBQP-LZCJLJQNSA-N |
| XLogP | -0.48 |
| TPSA | 139.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|