C11H10N6O2 — CID 142096883
triazolo[4,5-b]pyridin-3-yl 4-amino-1-methylpyrrole-2-carboxylate (PubChem CID 142096883) has the molecular formula C11H10N6O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is triazolo[4,5-b]pyridin-3-yl 4-amino-1-methylpyrrole-2-carboxylate.
| Compound Name | triazolo[4,5-b]pyridin-3-yl 4-amino-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 142096883 |
| Molecular Formula | C11H10N6O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | triazolo[4,5-b]pyridin-3-yl 4-amino-1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cc(N)cc1C(=O)On1nnc2cccnc21 |
| InChI | InChI=1S/C11H10N6O2/c1-16-6-7(12)5-9(16)11(18)19-17-10-8(14-15-17)3-2-4-13-10/h2-6H,12H2,1H3 |
| InChIKey | DIUOHEYIAQGNPW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|