About methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate
methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate (PubChem CID 65364857) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate |
| PubChem CID | 65364857 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate |
| SMILES | COCOC(=O)c1cc(N)cn1C |
| InChI | InChI=1S/C8H12N2O3/c1-10-4-6(9)3-7(10)8(11)13-5-12-2/h3-4H,5,9H2,1-2H3 |
| InChIKey | LHMKHTWHAYUMDE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate?
The IUPAC name of methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate (CID 65364857) is methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate.
What is the SMILES notation for methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate?
The canonical SMILES for methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate is COCOC(=O)c1cc(N)cn1C.
What is the InChIKey of methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate?
The InChIKey is LHMKHTWHAYUMDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-10-4-6(9)3-7(10)8(11)13-5-12-2/h3-4H,5,9H2,1-2H3.
What are the key properties of methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate?
methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate has a molecular weight of 184.19 g/mol, XLogP of 0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethyl 4-amino-1-methylpyrrole-2-carboxylate is sourced from PubChem (CID 65364857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).