C9H14N2O3 — CID 65279686
2-hydroxypropyl 4-amino-1-methylpyrrole-2-carboxylate (PubChem CID 65279686) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-hydroxypropyl 4-amino-1-methylpyrrole-2-carboxylate.
| Compound Name | 2-hydroxypropyl 4-amino-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 65279686 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-hydroxypropyl 4-amino-1-methylpyrrole-2-carboxylate |
| SMILES | CC(O)COC(=O)c1cc(N)cn1C |
| InChI | InChI=1S/C9H14N2O3/c1-6(12)5-14-9(13)8-3-7(10)4-11(8)2/h3-4,6,12H,5,10H2,1-2H3 |
| InChIKey | NUERGKCRMVOTMG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |