C12H19N3O3 — CID 61323051
[1-oxo-1-(propylamino)propan-2-yl] 4-amino-1-methylpyrrole-2-carboxylate (PubChem CID 61323051) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is [1-oxo-1-(propylamino)propan-2-yl] 4-amino-1-methylpyrrole-2-carboxylate.
| Compound Name | [1-oxo-1-(propylamino)propan-2-yl] 4-amino-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61323051 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | [1-oxo-1-(propylamino)propan-2-yl] 4-amino-1-methylpyrrole-2-carboxylate |
| SMILES | CCCNC(=O)C(C)OC(=O)c1cc(N)cn1C |
| InChI | InChI=1S/C12H19N3O3/c1-4-5-14-11(16)8(2)18-12(17)10-6-9(13)7-15(10)3/h6-8H,4-5,13H2,1-3H3,(H,14,16) |
| InChIKey | ZJTUPNDHZRDAOH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |