C8H6N4O2 — CID 154003219
triazolo[4,5-b]pyridin-3-yl prop-2-enoate (PubChem CID 154003219) has the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. Its IUPAC name is triazolo[4,5-b]pyridin-3-yl prop-2-enoate.
| Compound Name | triazolo[4,5-b]pyridin-3-yl prop-2-enoate |
|---|---|
| PubChem CID | 154003219 |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | triazolo[4,5-b]pyridin-3-yl prop-2-enoate |
| SMILES | C=CC(=O)On1nnc2cccnc21 |
| InChI | InChI=1S/C8H6N4O2/c1-2-7(13)14-12-8-6(10-11-12)4-3-5-9-8/h2-5H,1H2 |
| InChIKey | HBMPHDGIKZIKTO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|