C16H22N6O4 — CID 88579104
1-O-tert-butyl 3-O-(triazolo[4,5-b]pyridin-3-yl) (3S,4S)-4-aminopiperidine-1,3-dicarboxylate (PubChem CID 88579104) has the molecular formula C16H22N6O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-(triazolo[4,5-b]pyridin-3-yl) (3S,4S)-4-aminopiperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-(triazolo[4,5-b]pyridin-3-yl) (3S,4S)-4-aminopiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 88579104 |
| Molecular Formula | C16H22N6O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-O-tert-butyl 3-O-(triazolo[4,5-b]pyridin-3-yl) (3S,4S)-4-aminopiperidine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](N)[C@@H](C(=O)On2nnc3cccnc32)C1 |
| InChI | InChI=1S/C16H22N6O4/c1-16(2,3)25-15(24)21-8-6-11(17)10(9-21)14(23)26-22-13-12(19-20-22)5-4-7-18-13/h4-5,7,10-11H,6,8-9,17H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | FEYHMRAFXYFABB-QWRGUYRKSA-N |
| XLogP | 0.37 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|