C14H19BrN2O2S — CID 90314813
tert-butyl 3-[(3-bromo-2-pyridinyl)sulfanyl]pyrrolidine-1-carboxylate (PubChem CID 90314813) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is tert-butyl 3-[(3-bromo-2-pyridinyl)sulfanyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-bromo-2-pyridinyl)sulfanyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90314813 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | tert-butyl 3-[(3-bromo-2-pyridinyl)sulfanyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Sc2ncccc2Br)C1 |
| InChI | InChI=1S/C14H19BrN2O2S/c1-14(2,3)19-13(18)17-8-6-10(9-17)20-12-11(15)5-4-7-16-12/h4-5,7,10H,6,8-9H2,1-3H3 |
| InChIKey | OHBWLLDGAIZOCJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |