C19H30N2O2S2 — CID 59541639
tert-butyl 3-[(3-tert-butylsulfanyl-2-pyridinyl)methylsulfanyl]pyrrolidine-1-carboxylate (PubChem CID 59541639) has the molecular formula C19H30N2O2S2 and a molecular weight of 382.60 g/mol. Its IUPAC name is tert-butyl 3-[(3-tert-butylsulfanyl-2-pyridinyl)methylsulfanyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-tert-butylsulfanyl-2-pyridinyl)methylsulfanyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59541639 |
| Molecular Formula | C19H30N2O2S2 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | tert-butyl 3-[(3-tert-butylsulfanyl-2-pyridinyl)methylsulfanyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(SCc2ncccc2SC(C)(C)C)C1 |
| InChI | InChI=1S/C19H30N2O2S2/c1-18(2,3)23-17(22)21-11-9-14(12-21)24-13-15-16(8-7-10-20-15)25-19(4,5)6/h7-8,10,14H,9,11-13H2,1-6H3 |
| InChIKey | CHSAGKFQTHNXTK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |