C16H20F3NO2S — CID 156543555
tert-butyl 3-[2-(trifluoromethyl)phenyl]sulfanylpyrrolidine-1-carboxylate (PubChem CID 156543555) has the molecular formula C16H20F3NO2S and a molecular weight of 347.40 g/mol. Its IUPAC name is tert-butyl 3-[2-(trifluoromethyl)phenyl]sulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(trifluoromethyl)phenyl]sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156543555 |
| Molecular Formula | C16H20F3NO2S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | tert-butyl 3-[2-(trifluoromethyl)phenyl]sulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Sc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H20F3NO2S/c1-15(2,3)22-14(21)20-9-8-11(10-20)23-13-7-5-4-6-12(13)16(17,18)19/h4-7,11H,8-10H2,1-3H3 |
| InChIKey | WDJZQPNVHNLXDH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |