C17H22F3NO2S — CID 169320002
tert-butyl 3-[[2-(trifluoromethyl)phenyl]sulfanylmethyl]pyrrolidine-1-carboxylate (PubChem CID 169320002) has the molecular formula C17H22F3NO2S and a molecular weight of 361.43 g/mol. Its IUPAC name is tert-butyl 3-[[2-(trifluoromethyl)phenyl]sulfanylmethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-(trifluoromethyl)phenyl]sulfanylmethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169320002 |
| Molecular Formula | C17H22F3NO2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | tert-butyl 3-[[2-(trifluoromethyl)phenyl]sulfanylmethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CSc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H22F3NO2S/c1-16(2,3)23-15(22)21-9-8-12(10-21)11-24-14-7-5-4-6-13(14)17(18,19)20/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | XQPSZTYOSLHYLX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |