C19H26F3NO3 — CID 166105200
tert-butyl (3S)-3-[1-[2-(trifluoromethyl)phenoxy]ethyl]piperidine-1-carboxylate (PubChem CID 166105200) has the molecular formula C19H26F3NO3 and a molecular weight of 373.42 g/mol. Its IUPAC name is tert-butyl (3S)-3-[1-[2-(trifluoromethyl)phenoxy]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[1-[2-(trifluoromethyl)phenoxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166105200 |
| Molecular Formula | C19H26F3NO3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | tert-butyl (3S)-3-[1-[2-(trifluoromethyl)phenoxy]ethyl]piperidine-1-carboxylate |
| SMILES | CC(Oc1ccccc1C(F)(F)F)[C@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H26F3NO3/c1-13(25-16-10-6-5-9-15(16)19(20,21)22)14-8-7-11-23(12-14)17(24)26-18(2,3)4/h5-6,9-10,13-14H,7-8,11-12H2,1-4H3/t13?,14-/m0/s1 |
| InChIKey | FQNCHYKRZZCBCV-KZUDCZAMSA-N |
| XLogP | 5.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |