C15H22N2O2S — CID 95387140
tert-butyl (3S)-3-pyridin-2-ylsulfanylpiperidine-1-carboxylate (PubChem CID 95387140) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is tert-butyl (3S)-3-pyridin-2-ylsulfanylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-pyridin-2-ylsulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 95387140 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | tert-butyl (3S)-3-pyridin-2-ylsulfanylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](Sc2ccccn2)C1 |
| InChI | InChI=1S/C15H22N2O2S/c1-15(2,3)19-14(18)17-10-6-7-12(11-17)20-13-8-4-5-9-16-13/h4-5,8-9,12H,6-7,10-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | GPNFYXYTEJVSDQ-LBPRGKRZSA-N |
| XLogP | 3.57 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |