C16H27N3O2 — CID 153338980
tert-butyl 4-aminopiperidine-1-carboxylate;2-methylpyridine (PubChem CID 153338980) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl 4-aminopiperidine-1-carboxylate;2-methylpyridine.
| Compound Name | tert-butyl 4-aminopiperidine-1-carboxylate;2-methylpyridine |
|---|---|
| PubChem CID | 153338980 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | tert-butyl 4-aminopiperidine-1-carboxylate;2-methylpyridine |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)CC1.Cc1ccccn1 |
| InChI | InChI=1S/C10H20N2O2.C6H7N/c1-10(2,3)14-9(13)12-6-4-8(11)5-7-12;1-6-4-2-3-5-7-6/h8H,4-7,11H2,1-3H3;2-5H,1H3 |
| InChIKey | SBHDFJSGFVARLL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |