C18H30N2O3 — CID 142239984
tert-butyl 4-aminopiperidine-1-carboxylate;2-phenylethanol (PubChem CID 142239984) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl 4-aminopiperidine-1-carboxylate;2-phenylethanol.
| Compound Name | tert-butyl 4-aminopiperidine-1-carboxylate;2-phenylethanol |
|---|---|
| PubChem CID | 142239984 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl 4-aminopiperidine-1-carboxylate;2-phenylethanol |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)CC1.OCCc1ccccc1 |
| InChI | InChI=1S/C10H20N2O2.C8H10O/c1-10(2,3)14-9(13)12-6-4-8(11)5-7-12;9-7-6-8-4-2-1-3-5-8/h8H,4-7,11H2,1-3H3;1-5,9H,6-7H2 |
| InChIKey | NNKMPJBINOKMEA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |