C22H28N2O2 — CID 170633547
tert-butyl 4-(3-methyl-2-pyridin-2-ylphenyl)piperidine-1-carboxylate (PubChem CID 170633547) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl 4-(3-methyl-2-pyridin-2-ylphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-methyl-2-pyridin-2-ylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170633547 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl 4-(3-methyl-2-pyridin-2-ylphenyl)piperidine-1-carboxylate |
| SMILES | Cc1cccc(C2CCN(C(=O)OC(C)(C)C)CC2)c1-c1ccccn1 |
| InChI | InChI=1S/C22H28N2O2/c1-16-8-7-9-18(20(16)19-10-5-6-13-23-19)17-11-14-24(15-12-17)21(25)26-22(2,3)4/h5-10,13,17H,11-12,14-15H2,1-4H3 |
| InChIKey | QUZAJEZZGCEJAO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |