C28H32N2O3 — CID 175122139
tert-butyl 4-[4-(2-methylphenyl)-2-pyridin-2-ylphenoxy]piperidine-1-carboxylate (PubChem CID 175122139) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-methylphenyl)-2-pyridin-2-ylphenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2-methylphenyl)-2-pyridin-2-ylphenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175122139 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | tert-butyl 4-[4-(2-methylphenyl)-2-pyridin-2-ylphenoxy]piperidine-1-carboxylate |
| SMILES | Cc1ccccc1-c1ccc(OC2CCN(C(=O)OC(C)(C)C)CC2)c(-c2ccccn2)c1 |
| InChI | InChI=1S/C28H32N2O3/c1-20-9-5-6-10-23(20)21-12-13-26(24(19-21)25-11-7-8-16-29-25)32-22-14-17-30(18-15-22)27(31)33-28(2,3)4/h5-13,16,19,22H,14-15,17-18H2,1-4H3 |
| InChIKey | YBLXDJRIKJXERA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |