C20H26N2O3 — CID 143199953
tert-butyl 4-(6-methylquinolin-4-yl)oxypiperidine-1-carboxylate (PubChem CID 143199953) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl 4-(6-methylquinolin-4-yl)oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-methylquinolin-4-yl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 143199953 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | tert-butyl 4-(6-methylquinolin-4-yl)oxypiperidine-1-carboxylate |
| SMILES | Cc1ccc2nccc(OC3CCN(C(=O)OC(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C20H26N2O3/c1-14-5-6-17-16(13-14)18(7-10-21-17)24-15-8-11-22(12-9-15)19(23)25-20(2,3)4/h5-7,10,13,15H,8-9,11-12H2,1-4H3 |
| InChIKey | AZRIHIQGBCZKLR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |