C18H25N3O2 — CID 167016405
tert-butyl 4-(5-methyl-2H-indazol-3-yl)piperidine-1-carboxylate (PubChem CID 167016405) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is tert-butyl 4-(5-methyl-2H-indazol-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-methyl-2H-indazol-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167016405 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | tert-butyl 4-(5-methyl-2H-indazol-3-yl)piperidine-1-carboxylate |
| SMILES | Cc1ccc2n[nH]c(C3CCN(C(=O)OC(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C18H25N3O2/c1-12-5-6-15-14(11-12)16(20-19-15)13-7-9-21(10-8-13)17(22)23-18(2,3)4/h5-6,11,13H,7-10H2,1-4H3,(H,19,20) |
| InChIKey | RSIXLIBRNBKMCC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |