C20H27N3O2 — CID 58548451
tert-butyl 4-(6-cyclopropyl-1H-benzimidazol-2-yl)piperidine-1-carboxylate (PubChem CID 58548451) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is tert-butyl 4-(6-cyclopropyl-1H-benzimidazol-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-cyclopropyl-1H-benzimidazol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58548451 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | tert-butyl 4-(6-cyclopropyl-1H-benzimidazol-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc3ccc(C4CC4)cc3[nH]2)CC1 |
| InChI | InChI=1S/C20H27N3O2/c1-20(2,3)25-19(24)23-10-8-14(9-11-23)18-21-16-7-6-15(13-4-5-13)12-17(16)22-18/h6-7,12-14H,4-5,8-11H2,1-3H3,(H,21,22) |
| InChIKey | JYABDRPRQLHGKN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |