C16H22N4O2 — CID 22308646
tert-butyl 4-(1H-imidazo[4,5-b]pyridin-2-yl)piperidine-1-carboxylate (PubChem CID 22308646) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is tert-butyl 4-(1H-imidazo[4,5-b]pyridin-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(1H-imidazo[4,5-b]pyridin-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22308646 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | tert-butyl 4-(1H-imidazo[4,5-b]pyridin-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc3ncccc3[nH]2)CC1 |
| InChI | InChI=1S/C16H22N4O2/c1-16(2,3)22-15(21)20-9-6-11(7-10-20)13-18-12-5-4-8-17-14(12)19-13/h4-5,8,11H,6-7,9-10H2,1-3H3,(H,17,18,19) |
| InChIKey | CTOVZPSNNZBULU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |