C19H24N4O3 — CID 136881552
tert-butyl 4-(6-oxo-4-pyridin-4-yl-1H-pyrimidin-2-yl)piperidine-1-carboxylate (PubChem CID 136881552) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is tert-butyl 4-(6-oxo-4-pyridin-4-yl-1H-pyrimidin-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-oxo-4-pyridin-4-yl-1H-pyrimidin-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 136881552 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | tert-butyl 4-(6-oxo-4-pyridin-4-yl-1H-pyrimidin-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc(-c3ccncc3)cc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C19H24N4O3/c1-19(2,3)26-18(25)23-10-6-14(7-11-23)17-21-15(12-16(24)22-17)13-4-8-20-9-5-13/h4-5,8-9,12,14H,6-7,10-11H2,1-3H3,(H,21,22,24) |
| InChIKey | DAPCEGQBBORIOZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |