C20H27N5O3 — CID 59576852
tert-butyl 3-[(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)amino]piperidine-1-carboxylate (PubChem CID 59576852) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is tert-butyl 3-[(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59576852 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | tert-butyl 3-[(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)amino]piperidine-1-carboxylate |
| SMILES | Cn1c(NC2CCCN(C(=O)OC(C)(C)C)C2)nc(-c2ccncc2)cc1=O |
| InChI | InChI=1S/C20H27N5O3/c1-20(2,3)28-19(27)25-11-5-6-15(13-25)22-18-23-16(12-17(26)24(18)4)14-7-9-21-10-8-14/h7-10,12,15H,5-6,11,13H2,1-4H3,(H,22,23) |
| InChIKey | DGKJYDCLNBCIAG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |