C19H25N5O3 — CID 143560928
tert-butyl 4-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)piperazine-1-carboxylate (PubChem CID 143560928) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is tert-butyl 4-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143560928 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | tert-butyl 4-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)piperazine-1-carboxylate |
| SMILES | Cn1c(N2CCN(C(=O)OC(C)(C)C)CC2)nc(-c2ccncc2)cc1=O |
| InChI | InChI=1S/C19H25N5O3/c1-19(2,3)27-18(26)24-11-9-23(10-12-24)17-21-15(13-16(25)22(17)4)14-5-7-20-8-6-14/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | AWIRFTRCDLKINN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |