C19H23BrN2O3 — CID 130367043
tert-butyl 4-(5-bromoisoquinolin-8-yl)oxypiperidine-1-carboxylate (PubChem CID 130367043) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is tert-butyl 4-(5-bromoisoquinolin-8-yl)oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-bromoisoquinolin-8-yl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 130367043 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | tert-butyl 4-(5-bromoisoquinolin-8-yl)oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(Br)c3ccncc23)CC1 |
| InChI | InChI=1S/C19H23BrN2O3/c1-19(2,3)25-18(23)22-10-7-13(8-11-22)24-17-5-4-16(20)14-6-9-21-12-15(14)17/h4-6,9,12-13H,7-8,10-11H2,1-3H3 |
| InChIKey | KCWMZAHECWXCMX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |