C15H21BrN2O3 — CID 119087105
tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]piperidine-1-carboxylate (PubChem CID 119087105) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 119087105 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(Br)nc2)CC1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-15(2,3)21-14(19)18-8-6-11(7-9-18)20-12-4-5-13(16)17-10-12/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | IUNJCOWNCCNSBH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|