C15H21BrN2O3 — CID 169188311
tert-butyl N-[(1R,3R)-3-[(6-bromo-3-pyridinyl)oxy]cyclopentyl]carbamate (PubChem CID 169188311) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is tert-butyl N-[(1R,3R)-3-[(6-bromo-3-pyridinyl)oxy]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3R)-3-[(6-bromo-3-pyridinyl)oxy]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 169188311 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | tert-butyl N-[(1R,3R)-3-[(6-bromo-3-pyridinyl)oxy]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](Oc2ccc(Br)nc2)C1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-15(2,3)21-14(19)18-10-4-5-11(8-10)20-12-6-7-13(16)17-9-12/h6-7,9-11H,4-5,8H2,1-3H3,(H,18,19)/t10-,11-/m1/s1 |
| InChIKey | KLMCZZRAYDOEMS-GHMZBOCLSA-N |
| XLogP | 3.67 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|