C18H27BrN2O3 — CID 166147913
tert-butyl N-[(1S,3R)-3-[(2-bromo-6-propyl-3-pyridinyl)oxy]cyclopentyl]carbamate (PubChem CID 166147913) has the molecular formula C18H27BrN2O3 and a molecular weight of 399.33 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-[(2-bromo-6-propyl-3-pyridinyl)oxy]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-[(2-bromo-6-propyl-3-pyridinyl)oxy]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 166147913 |
| Molecular Formula | C18H27BrN2O3 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-[(2-bromo-6-propyl-3-pyridinyl)oxy]cyclopentyl]carbamate |
| SMILES | CCCc1ccc(O[C@@H]2CC[C@H](NC(=O)OC(C)(C)C)C2)c(Br)n1 |
| InChI | InChI=1S/C18H27BrN2O3/c1-5-6-12-8-10-15(16(19)20-12)23-14-9-7-13(11-14)21-17(22)24-18(2,3)4/h8,10,13-14H,5-7,9,11H2,1-4H3,(H,21,22)/t13-,14+/m0/s1 |
| InChIKey | RZKWADLMSFXTAV-UONOGXRCSA-N |
| XLogP | 4.62 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|