C16H20BrClFNO3 — CID 170071286
tert-butyl N-[(1R,3R)-3-(2-bromo-5-chloro-3-fluorophenoxy)cyclopentyl]carbamate (PubChem CID 170071286) has the molecular formula C16H20BrClFNO3 and a molecular weight of 408.70 g/mol. Its IUPAC name is tert-butyl N-[(1R,3R)-3-(2-bromo-5-chloro-3-fluorophenoxy)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3R)-3-(2-bromo-5-chloro-3-fluorophenoxy)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 170071286 |
| Molecular Formula | C16H20BrClFNO3 |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | tert-butyl N-[(1R,3R)-3-(2-bromo-5-chloro-3-fluorophenoxy)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](Oc2cc(Cl)cc(F)c2Br)C1 |
| InChI | InChI=1S/C16H20BrClFNO3/c1-16(2,3)23-15(21)20-10-4-5-11(8-10)22-13-7-9(18)6-12(19)14(13)17/h6-7,10-11H,4-5,8H2,1-3H3,(H,20,21)/t10-,11-/m1/s1 |
| InChIKey | JMDSNKCSFQVCDE-GHMZBOCLSA-N |
| XLogP | 5.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|