C17H25ClN2O3 — CID 103719625
tert-butyl N-[3-(5-chloro-2-methoxyanilino)cyclopentyl]carbamate (PubChem CID 103719625) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is tert-butyl N-[3-(5-chloro-2-methoxyanilino)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-chloro-2-methoxyanilino)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 103719625 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | tert-butyl N-[3-(5-chloro-2-methoxyanilino)cyclopentyl]carbamate |
| SMILES | COc1ccc(Cl)cc1NC1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H25ClN2O3/c1-17(2,3)23-16(21)20-13-7-6-12(10-13)19-14-9-11(18)5-8-15(14)22-4/h5,8-9,12-13,19H,6-7,10H2,1-4H3,(H,20,21) |
| InChIKey | NQTMZXRNWGSPOZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |