C17H24ClN3O4 — CID 166590618
6-chloro-4-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]pyridine-3-carboxylic acid (PubChem CID 166590618) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is 6-chloro-4-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-4-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 166590618 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 6-chloro-4-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]pyridine-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NC1CCCC(Nc2cc(Cl)ncc2C(=O)O)C1 |
| InChI | InChI=1S/C17H24ClN3O4/c1-17(2,3)25-16(24)21-11-6-4-5-10(7-11)20-13-8-14(18)19-9-12(13)15(22)23/h8-11H,4-7H2,1-3H3,(H,19,20)(H,21,24)(H,22,23) |
| InChIKey | FQGBZCRIJKFGMN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|