C14H20ClN3O2 — CID 80559539
tert-butyl N-[3-[(2-chloro-3-pyridinyl)amino]cyclobutyl]carbamate (PubChem CID 80559539) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-chloro-3-pyridinyl)amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2-chloro-3-pyridinyl)amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 80559539 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | tert-butyl N-[3-[(2-chloro-3-pyridinyl)amino]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(Nc2cccnc2Cl)C1 |
| InChI | InChI=1S/C14H20ClN3O2/c1-14(2,3)20-13(19)18-10-7-9(8-10)17-11-5-4-6-16-12(11)15/h4-6,9-10,17H,7-8H2,1-3H3,(H,18,19) |
| InChIKey | NMDKDPSYYUZCIL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|