C15H20Cl2N2O2 — CID 80559110
tert-butyl N-[3-(3,4-dichloroanilino)cyclobutyl]carbamate (PubChem CID 80559110) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is tert-butyl N-[3-(3,4-dichloroanilino)cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-(3,4-dichloroanilino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 80559110 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | tert-butyl N-[3-(3,4-dichloroanilino)cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(Nc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-15(2,3)21-14(20)19-11-6-10(7-11)18-9-4-5-12(16)13(17)8-9/h4-5,8,10-11,18H,6-7H2,1-3H3,(H,19,20) |
| InChIKey | YJASSFVQROEMBB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |