C18H27ClN2O4 — CID 113247793
tert-butyl N-[3-(4-chloro-2,5-dimethoxyanilino)cyclopentyl]carbamate (PubChem CID 113247793) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chloro-2,5-dimethoxyanilino)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chloro-2,5-dimethoxyanilino)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 113247793 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tert-butyl N-[3-(4-chloro-2,5-dimethoxyanilino)cyclopentyl]carbamate |
| SMILES | COc1cc(NC2CCC(NC(=O)OC(C)(C)C)C2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H27ClN2O4/c1-18(2,3)25-17(22)21-12-7-6-11(8-12)20-14-10-15(23-4)13(19)9-16(14)24-5/h9-12,20H,6-8H2,1-5H3,(H,21,22) |
| InChIKey | XJNJLJGDUPGVRY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |