C19H21ClN2O3 — CID 103392787
benzyl N-[3-(5-chloro-2-methoxyanilino)cyclobutyl]carbamate (PubChem CID 103392787) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is benzyl N-[3-(5-chloro-2-methoxyanilino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(5-chloro-2-methoxyanilino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103392787 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | benzyl N-[3-(5-chloro-2-methoxyanilino)cyclobutyl]carbamate |
| SMILES | COc1ccc(Cl)cc1NC1CC(NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-24-18-8-7-14(20)9-17(18)21-15-10-16(11-15)22-19(23)25-12-13-5-3-2-4-6-13/h2-9,15-16,21H,10-12H2,1H3,(H,22,23) |
| InChIKey | UOWCLKJTIYIWEX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |