C20H24N2O4 — CID 103392778
benzyl N-[3-(2,5-dimethoxyanilino)cyclobutyl]carbamate (PubChem CID 103392778) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is benzyl N-[3-(2,5-dimethoxyanilino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(2,5-dimethoxyanilino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103392778 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | benzyl N-[3-(2,5-dimethoxyanilino)cyclobutyl]carbamate |
| SMILES | COc1ccc(OC)c(NC2CC(NC(=O)OCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-24-17-8-9-19(25-2)18(12-17)21-15-10-16(11-15)22-20(23)26-13-14-6-4-3-5-7-14/h3-9,12,15-16,21H,10-11,13H2,1-2H3,(H,22,23) |
| InChIKey | ZZOGHTZIAIIENR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |