C20H24N2O3 — CID 103393149
benzyl N-[3-(3-hydroxy-2,4-dimethylanilino)cyclobutyl]carbamate (PubChem CID 103393149) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is benzyl N-[3-(3-hydroxy-2,4-dimethylanilino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(3-hydroxy-2,4-dimethylanilino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103393149 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | benzyl N-[3-(3-hydroxy-2,4-dimethylanilino)cyclobutyl]carbamate |
| SMILES | Cc1ccc(NC2CC(NC(=O)OCc3ccccc3)C2)c(C)c1O |
| InChI | InChI=1S/C20H24N2O3/c1-13-8-9-18(14(2)19(13)23)21-16-10-17(11-16)22-20(24)25-12-15-6-4-3-5-7-15/h3-9,16-17,21,23H,10-12H2,1-2H3,(H,22,24) |
| InChIKey | NBPOIRZQBRFQHR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |