C20H23BrN2O2 — CID 103393636
benzyl N-[3-(2-bromo-4,6-dimethylanilino)cyclobutyl]carbamate (PubChem CID 103393636) has the molecular formula C20H23BrN2O2 and a molecular weight of 403.32 g/mol. Its IUPAC name is benzyl N-[3-(2-bromo-4,6-dimethylanilino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(2-bromo-4,6-dimethylanilino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103393636 |
| Molecular Formula | C20H23BrN2O2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | benzyl N-[3-(2-bromo-4,6-dimethylanilino)cyclobutyl]carbamate |
| SMILES | Cc1cc(C)c(NC2CC(NC(=O)OCc3ccccc3)C2)c(Br)c1 |
| InChI | InChI=1S/C20H23BrN2O2/c1-13-8-14(2)19(18(21)9-13)22-16-10-17(11-16)23-20(24)25-12-15-6-4-3-5-7-15/h3-9,16-17,22H,10-12H2,1-2H3,(H,23,24) |
| InChIKey | YRZKRMYORAGAJL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |