C18H19IN2O2 — CID 103392947
benzyl N-[3-(3-iodoanilino)cyclobutyl]carbamate (PubChem CID 103392947) has the molecular formula C18H19IN2O2 and a molecular weight of 422.27 g/mol. Its IUPAC name is benzyl N-[3-(3-iodoanilino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(3-iodoanilino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103392947 |
| Molecular Formula | C18H19IN2O2 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | benzyl N-[3-(3-iodoanilino)cyclobutyl]carbamate |
| SMILES | O=C(NC1CC(Nc2cccc(I)c2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C18H19IN2O2/c19-14-7-4-8-15(9-14)20-16-10-17(11-16)21-18(22)23-12-13-5-2-1-3-6-13/h1-9,16-17,20H,10-12H2,(H,21,22) |
| InChIKey | BOPBYABISVCWLD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|