C19H21N3O3 — CID 103392870
benzyl N-[3-(3-carbamoylanilino)cyclobutyl]carbamate (PubChem CID 103392870) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is benzyl N-[3-(3-carbamoylanilino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(3-carbamoylanilino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103392870 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | benzyl N-[3-(3-carbamoylanilino)cyclobutyl]carbamate |
| SMILES | NC(=O)c1cccc(NC2CC(NC(=O)OCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H21N3O3/c20-18(23)14-7-4-8-15(9-14)21-16-10-17(11-16)22-19(24)25-12-13-5-2-1-3-6-13/h1-9,16-17,21H,10-12H2,(H2,20,23)(H,22,24) |
| InChIKey | BVQGPOVUYOEVBQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |