C18H18Cl2N2O2 — CID 103392779
benzyl N-[3-(3,5-dichloroanilino)cyclobutyl]carbamate (PubChem CID 103392779) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is benzyl N-[3-(3,5-dichloroanilino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(3,5-dichloroanilino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103392779 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | benzyl N-[3-(3,5-dichloroanilino)cyclobutyl]carbamate |
| SMILES | O=C(NC1CC(Nc2cc(Cl)cc(Cl)c2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c19-13-6-14(20)8-15(7-13)21-16-9-17(10-16)22-18(23)24-11-12-4-2-1-3-5-12/h1-8,16-17,21H,9-11H2,(H,22,23) |
| InChIKey | GTONVEVMLAPHAT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |