C19H20N4O2 — CID 103393058
benzyl N-[3-(1H-indazol-5-ylamino)cyclobutyl]carbamate (PubChem CID 103393058) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is benzyl N-[3-(1H-indazol-5-ylamino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(1H-indazol-5-ylamino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103393058 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | benzyl N-[3-(1H-indazol-5-ylamino)cyclobutyl]carbamate |
| SMILES | O=C(NC1CC(Nc2ccc3[nH]ncc3c2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C19H20N4O2/c24-19(25-12-13-4-2-1-3-5-13)22-17-9-16(10-17)21-15-6-7-18-14(8-15)11-20-23-18/h1-8,11,16-17,21H,9-10,12H2,(H,20,23)(H,22,24) |
| InChIKey | MANZRUGUHCMTSA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |