C18H25BrClFN2O3 — CID 171109323
tert-butyl N-[1-[2-(2-bromo-4-chloro-6-fluorophenoxy)ethyl]piperidin-4-yl]carbamate (PubChem CID 171109323) has the molecular formula C18H25BrClFN2O3 and a molecular weight of 451.76 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(2-bromo-4-chloro-6-fluorophenoxy)ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(2-bromo-4-chloro-6-fluorophenoxy)ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 171109323 |
| Molecular Formula | C18H25BrClFN2O3 |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | tert-butyl N-[1-[2-(2-bromo-4-chloro-6-fluorophenoxy)ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCOc2c(F)cc(Cl)cc2Br)CC1 |
| InChI | InChI=1S/C18H25BrClFN2O3/c1-18(2,3)26-17(24)22-13-4-6-23(7-5-13)8-9-25-16-14(19)10-12(20)11-15(16)21/h10-11,13H,4-9H2,1-3H3,(H,22,24) |
| InChIKey | JAHIYENPQUZIHH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |