C18H25ClFN3O3 — CID 60512994
tert-butyl N-[1-[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]piperidin-4-yl]carbamate (PubChem CID 60512994) has the molecular formula C18H25ClFN3O3 and a molecular weight of 385.87 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 60512994 |
| Molecular Formula | C18H25ClFN3O3 |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | tert-butyl N-[1-[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC(=O)Nc2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C18H25ClFN3O3/c1-18(2,3)26-17(25)21-13-6-8-23(9-7-13)11-16(24)22-15-10-12(19)4-5-14(15)20/h4-5,10,13H,6-9,11H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | FGYCQGWAYJSLLU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |